C26H54O4Si2 — CID 10601002
ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enoate (PubChem CID 10601002) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enoate.
| Compound Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enoate |
|---|---|
| PubChem CID | 10601002 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O[Si](C)(C)C)C(C)(C)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si2/c1-14-16-17-18-22(29-32(12,13)25(4,5)6)20-19-21(3)23(30-31(9,10)11)26(7,8)24(27)28-15-2/h19,22-23H,14-18,20H2,1-13H3/b21-19+/t22-,23-/m1/s1 |
| InChIKey | IDIHAMLQYJTHJT-NEIUCXMYSA-N |
| XLogP | 8.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|