C30H54O4Si — CID 10553628
tert-butyl (6E,8S,11E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6,8,12-trimethyl-4,10-dimethylidenepentadeca-6,11-dienoate (PubChem CID 10553628) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is tert-butyl (6E,8S,11E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6,8,12-trimethyl-4,10-dimethylidenepentadeca-6,11-dienoate.
| Compound Name | tert-butyl (6E,8S,11E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6,8,12-trimethyl-4,10-dimethylidenepentadeca-6,11-dienoate |
|---|---|
| PubChem CID | 10553628 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | tert-butyl (6E,8S,11E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6,8,12-trimethyl-4,10-dimethylidenepentadeca-6,11-dienoate |
| SMILES | C=C(/C=C(\C)[C@@H](CC)O[Si](C)(C)C(C)(C)C)C[C@H](C)/C=C(\C)CC(=C)C(O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H54O4Si/c1-15-27(34-35(13,14)30(10,11)12)25(6)19-23(4)17-21(2)16-22(3)18-24(5)26(31)20-28(32)33-29(7,8)9/h16,19,21,26-27,31H,4-5,15,17-18,20H2,1-3,6-14H3/b22-16+,25-19+/t21-,26?,27-/m1/s1 |
| InChIKey | ULWMIXFHKAWWTO-CSWBWBJYSA-N |
| XLogP | 8.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|