C19H36O4Si — CID 11416998
2-[(2R,3R,6S)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]acetic acid (PubChem CID 11416998) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11416998 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-[(2R,3R,6S)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]acetic acid |
| SMILES | C/C=C/C(C[C@@H]1CC[C@@H](C)[C@@H](CC(=O)O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-8-9-16(23-24(6,7)19(3,4)5)12-15-11-10-14(2)17(22-15)13-18(20)21/h8-9,14-17H,10-13H2,1-7H3,(H,20,21)/b9-8+/t14-,15+,16?,17-/m1/s1 |
| InChIKey | KUDGIVPLPYCXMX-BPSXEULYSA-N |
| XLogP | 5.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|