C28H50O5Si — CID 10097282
ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S)-1,3-dihydroxypent-4-enyl]-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10097282) has the molecular formula C28H50O5Si and a molecular weight of 494.79 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S)-1,3-dihydroxypent-4-enyl]-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S)-1,3-dihydroxypent-4-enyl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10097282 |
| Molecular Formula | C28H50O5Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S)-1,3-dihydroxypent-4-enyl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | C=C[C@@H](O)C[C@@H](O)[C@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C28H50O5Si/c1-11-24(29)20-25(30)28(8,26(31)32-12-2)19-18-22(3)16-14-13-15-17-23(4)21-33-34(9,10)27(5,6)7/h11,14,16-18,24-25,29-30H,1,12-13,15,19-21H2,2-10H3/b16-14+,22-18+,23-17+/t24-,25-,28+/m1/s1 |
| InChIKey | AOQDMXWCMMCDLA-BXJNHOHWSA-N |
| XLogP | 6.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|