C27H52O5Si — CID 135045945
methyl (5Z,9R,11S,13E,15S)-9-[tert-butyl(dimethyl)silyl]oxy-11,15-dihydroxyicosa-5,13-dienoate (PubChem CID 135045945) has the molecular formula C27H52O5Si and a molecular weight of 484.79 g/mol. Its IUPAC name is methyl (5Z,9R,11S,13E,15S)-9-[tert-butyl(dimethyl)silyl]oxy-11,15-dihydroxyicosa-5,13-dienoate.
| Compound Name | methyl (5Z,9R,11S,13E,15S)-9-[tert-butyl(dimethyl)silyl]oxy-11,15-dihydroxyicosa-5,13-dienoate |
|---|---|
| PubChem CID | 135045945 |
| Molecular Formula | C27H52O5Si |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (5Z,9R,11S,13E,15S)-9-[tert-butyl(dimethyl)silyl]oxy-11,15-dihydroxyicosa-5,13-dienoate |
| SMILES | CCCCC[C@H](O)/C=C/C[C@H](O)C[C@@H](CC/C=C\CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O5Si/c1-8-9-13-17-23(28)18-16-19-24(29)22-25(32-33(6,7)27(2,3)4)20-14-11-10-12-15-21-26(30)31-5/h10-11,16,18,23-25,28-29H,8-9,12-15,17,19-22H2,1-7H3/b11-10-,18-16+/t23-,24-,25+/m0/s1 |
| InChIKey | UODWVTNRTRBGMH-KQQUVKCXSA-N |
| XLogP | 6.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|