C25H52O5Si2 — CID 101166397
methyl (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoate (PubChem CID 101166397) has the molecular formula C25H52O5Si2 and a molecular weight of 488.86 g/mol. Its IUPAC name is methyl (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoate.
| Compound Name | methyl (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoate |
|---|---|
| PubChem CID | 101166397 |
| Molecular Formula | C25H52O5Si2 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | methyl (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoate |
| SMILES | CCC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O5Si2/c1-13-17-20(26)23(30-32(11,12)25(5,6)7)21(29-31(9,10)24(2,3)4)18-15-14-16-19-22(27)28-8/h15,18,20-21,23,26H,13-14,16-17,19H2,1-12H3/b18-15+/t20-,21+,23-/m1/s1 |
| InChIKey | XXOCWNOQNAKHOP-XPDFKTDGSA-N |
| XLogP | 6.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|