C30H62O5Si3 — CID 134974586
(2R,3R,4S,5E,9R)-3,4,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 134974586) has the molecular formula C30H62O5Si3 and a molecular weight of 587.08 g/mol. Its IUPAC name is (2R,3R,4S,5E,9R)-3,4,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3R,4S,5E,9R)-3,4,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 134974586 |
| Molecular Formula | C30H62O5Si3 |
| Molecular Weight | 587.08 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | (2R,3R,4S,5E,9R)-3,4,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCC[C@H]1OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)CC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O5Si3/c1-17-20-23-26(35-38(15,16)30(8,9)10)24(33-36(11,12)28(2,3)4)21-18-19-22-25(27(31)32-23)34-37(13,14)29(5,6)7/h18,21,23-26H,17,19-20,22H2,1-16H3/b21-18+/t23-,24+,25-,26-/m1/s1 |
| InChIKey | YTNIIAAIDLKPBB-KAWZPGMASA-N |
| XLogP | 9.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.08 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|