C28H56O5Si2 — CID 134842208
(2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-7-hydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 134842208) has the molecular formula C28H56O5Si2 and a molecular weight of 528.92 g/mol. Its IUPAC name is (2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-7-hydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-7-hydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 134842208 |
| Molecular Formula | C28H56O5Si2 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | (2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-7-hydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCC[C@H]1OC(=O)CC[C@H](O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O5Si2/c1-12-13-14-15-16-17-23-26(33-35(10,11)28(5,6)7)24(32-34(8,9)27(2,3)4)20-18-22(29)19-21-25(30)31-23/h18,20,22-24,26,29H,12-17,19,21H2,1-11H3/b20-18+/t22-,23-,24+,26-/m1/s1 |
| InChIKey | IXMMCEJNMXPZHY-FYOCGPAHSA-N |
| XLogP | 7.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|