C24H48O5Si — CID 134839438
(E,9R,12R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxyoctadec-10-enoic acid (PubChem CID 134839438) has the molecular formula C24H48O5Si and a molecular weight of 444.73 g/mol. Its IUPAC name is (E,9R,12R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxyoctadec-10-enoic acid.
| Compound Name | (E,9R,12R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxyoctadec-10-enoic acid |
|---|---|
| PubChem CID | 134839438 |
| Molecular Formula | C24H48O5Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | (E,9R,12R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxyoctadec-10-enoic acid |
| SMILES | CCCCC[C@@H](O)[C@H](O)/C=C/[C@@H](CCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O5Si/c1-7-8-12-16-21(25)22(26)19-18-20(29-30(5,6)24(2,3)4)15-13-10-9-11-14-17-23(27)28/h18-22,25-26H,7-17H2,1-6H3,(H,27,28)/b19-18+/t20-,21-,22-/m1/s1 |
| InChIKey | HZTQBSJYOWGAIP-SOQYCCDQSA-N |
| XLogP | 6.05 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|