C32H60O8Si2 — CID 134842209
4-[[(2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid (PubChem CID 134842209) has the molecular formula C32H60O8Si2 and a molecular weight of 629.00 g/mol. Its IUPAC name is 4-[[(2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134842209 |
| Molecular Formula | C32H60O8Si2 |
| Molecular Weight | 629.00 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 4-[[(2R,3R,4S,5E,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-heptyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid |
| SMILES | CCCCCCC[C@H]1OC(=O)CC[C@H](OC(=O)CCC(=O)O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O8Si2/c1-12-13-14-15-16-17-25-30(40-42(10,11)32(5,6)7)26(39-41(8,9)31(2,3)4)20-18-24(19-22-29(36)38-25)37-28(35)23-21-27(33)34/h18,20,24-26,30H,12-17,19,21-23H2,1-11H3,(H,33,34)/b20-18+/t24-,25-,26+,30-/m1/s1 |
| InChIKey | JYFAEFFQDKGFNM-WASYLEACSA-N |
| XLogP | 8.17 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.00 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|