C38H76O6Si3 — CID 11578487
(Z)-7-[(2S,3S,5S)-5-[(E,1R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-enoic acid (PubChem CID 11578487) has the molecular formula C38H76O6Si3 and a molecular weight of 713.28 g/mol. Its IUPAC name is (Z)-7-[(2S,3S,5S)-5-[(E,1R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,3S,5S)-5-[(E,1R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11578487 |
| Molecular Formula | C38H76O6Si3 |
| Molecular Weight | 713.28 g/mol |
| Exact Mass | 712.49 |
| IUPAC Name | (Z)-7-[(2S,3S,5S)-5-[(E,1R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C/C=C\CCCC(=O)O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H76O6Si3/c1-17-18-21-24-30(42-45(11,12)36(2,3)4)27-28-32(43-46(13,14)37(5,6)7)33-29-34(44-47(15,16)38(8,9)10)31(41-33)25-22-19-20-23-26-35(39)40/h19,22,27-28,30-34H,17-18,20-21,23-26,29H2,1-16H3,(H,39,40)/b22-19-,28-27+/t30-,31+,32-,33+,34+/m1/s1 |
| InChIKey | UAOGLVKRDUAPAU-GPDWVPFGSA-N |
| XLogP | 11.65 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.28 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|