C26H46O4Si2 — CID 134885252
[(2R,3R,5R)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl] acetate (PubChem CID 134885252) has the molecular formula C26H46O4Si2 and a molecular weight of 478.82 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 134885252 |
| Molecular Formula | C26H46O4Si2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(2R,3R,5R)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl] acetate |
| SMILES | CC/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](OC(C)=O)[C@@H](C/C=C/C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C26H46O4Si2/c1-11-12-14-18-23(30-32(9,10)26(3,4)5)25-20-24(28-21(2)27)22(29-25)17-15-13-16-19-31(6,7)8/h12-15,22-25H,11,17-18,20H2,1-10H3/b14-12+,15-13+/t22-,23+,24-,25-/m1/s1 |
| InChIKey | VHFFFDKTXCXVPE-IVBHMBRISA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|