C23H38O5Si — CID 91097886
(1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,16,16-trimethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one (PubChem CID 91097886) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,16,16-trimethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one.
| Compound Name | (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,16,16-trimethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one |
|---|---|
| PubChem CID | 91097886 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,16,16-trimethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one |
| SMILES | C[C@H]1CC=C[C@H]2OC(C)(C)O[C@H]2CCC(O[Si](C)(C)C(C)(C)C)CC#CC(=O)O1 |
| InChI | InChI=1S/C23H38O5Si/c1-17-11-9-13-19-20(27-23(5,6)26-19)16-15-18(12-10-14-21(24)25-17)28-29(7,8)22(2,3)4/h9,13,17-20H,11-12,15-16H2,1-8H3/t17-,18?,19+,20-/m0/s1 |
| InChIKey | UURSHBPGMWMMMS-XGKJMYGNSA-N |
| XLogP | 4.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|