C19H30O3Si — CID 11461785
tert-butyl-[[(1R,5S,13S)-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,8,11-trien-8-yl]oxy]-dimethylsilane (PubChem CID 11461785) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is tert-butyl-[[(1R,5S,13S)-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,8,11-trien-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,5S,13S)-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,8,11-trien-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11461785 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl-[[(1R,5S,13S)-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,8,11-trien-8-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)O[C@H]2C=CC(O[Si](C)(C)C(C)(C)C)=C3CC=C[C@@H](O1)[C@H]32 |
| InChI | InChI=1S/C19H30O3Si/c1-18(2,3)23(6,7)22-14-11-12-16-17-13(14)9-8-10-15(17)20-19(4,5)21-16/h8,10-12,15-17H,9H2,1-7H3/t15-,16+,17+/m1/s1 |
| InChIKey | QMGFOUPYLCEHJL-IKGGRYGDSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|