C13H25NO2Si — CID 11357288
(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,5-dihydropyridin-6-one (PubChem CID 11357288) has the molecular formula C13H25NO2Si and a molecular weight of 255.43 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,5-dihydropyridin-6-one.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 11357288 |
| Molecular Formula | C13H25NO2Si |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,5-dihydropyridin-6-one |
| SMILES | CN1C(=O)CC=C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2Si/c1-13(2,3)17(5,6)16-10-11-8-7-9-12(15)14(11)4/h7-8,11H,9-10H2,1-6H3/t11-/m1/s1 |
| InChIKey | YAPYTBYFXKCSCI-LLVKDONJSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|