C19H34O2Si — CID 10687324
(3R,4aR,7S,8R,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 10687324) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (3R,4aR,7S,8R,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (3R,4aR,7S,8R,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10687324 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3R,4aR,7S,8R,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@H]1CC(=O)[C@H]2[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C19H34O2Si/c1-13-10-15-9-8-14(2)16(18(15)17(20)11-13)12-21-22(6,7)19(3,4)5/h8-9,13-16,18H,10-12H2,1-7H3/t13-,14+,15+,16-,18-/m1/s1 |
| InChIKey | GTEWNIUKSSTDFI-QYXWGXCQSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|