C14H25NO4Si — CID 162091438
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-2,6-dihydropyridine-1-carboxylic acid (PubChem CID 162091438) has the molecular formula C14H25NO4Si and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-2,6-dihydropyridine-1-carboxylic acid.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-2,6-dihydropyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 162091438 |
| Molecular Formula | C14H25NO4Si |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-2,6-dihydropyridine-1-carboxylic acid |
| SMILES | CC1=CC(CO[Si](C)(C)C(C)(C)C)N(C(=O)O)CC1=O |
| InChI | InChI=1S/C14H25NO4Si/c1-10-7-11(15(13(17)18)8-12(10)16)9-19-20(5,6)14(2,3)4/h7,11H,8-9H2,1-6H3,(H,17,18) |
| InChIKey | ZDQXAUAYLHGYLU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|