C29H33NO3Si — CID 174056820
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 174056820) has the molecular formula C29H33NO3Si and a molecular weight of 471.67 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 174056820 |
| Molecular Formula | C29H33NO3Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | Cc1ccccc1C1=CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)O)C1 |
| InChI | InChI=1S/C29H33NO3Si/c1-22-13-11-12-18-27(22)23-19-24(30(20-23)28(31)32)21-33-34(29(2,3)4,25-14-7-5-8-15-25)26-16-9-6-10-17-26/h5-19,24H,20-21H2,1-4H3,(H,31,32) |
| InChIKey | CUFFSQZGDYPAFE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|