C27H30N2O3Si — CID 174107446
(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pyridin-3-yl-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 174107446) has the molecular formula C27H30N2O3Si and a molecular weight of 458.63 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pyridin-3-yl-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pyridin-3-yl-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 174107446 |
| Molecular Formula | C27H30N2O3Si |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pyridin-3-yl-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C=C(c2cccnc2)CN1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O3Si/c1-27(2,3)33(24-12-6-4-7-13-24,25-14-8-5-9-15-25)32-20-23-17-22(19-29(23)26(30)31)21-11-10-16-28-18-21/h4-18,23H,19-20H2,1-3H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | YAWHJRQQBSYFST-QHCPKHFHSA-N |
| XLogP | 4.40 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|