C15H26ClNO4Si — CID 87828403
(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-chloroacetyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 87828403) has the molecular formula C15H26ClNO4Si and a molecular weight of 347.92 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-chloroacetyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-chloroacetyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 87828403 |
| Molecular Formula | C15H26ClNO4Si |
| Molecular Weight | 347.92 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-chloroacetyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(C(=O)CCl)=CCN1C(=O)O |
| InChI | InChI=1S/C15H26ClNO4Si/c1-15(2,3)22(4,5)21-10-12-8-11(13(18)9-16)6-7-17(12)14(19)20/h6,12H,7-10H2,1-5H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | OBQUCQNNWYRFMA-GFCCVEGCSA-N |
| XLogP | 3.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|