C15H28ClNO2Si — CID 58782054
1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-2-chloroethanone (PubChem CID 58782054) has the molecular formula C15H28ClNO2Si and a molecular weight of 317.93 g/mol. Its IUPAC name is 1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-2-chloroethanone.
| Compound Name | 1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 58782054 |
| Molecular Formula | C15H28ClNO2Si |
| Molecular Weight | 317.93 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-2-chloroethanone |
| SMILES | CN1CC=C(C(=O)CCl)C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28ClNO2Si/c1-15(2,3)20(5,6)19-11-13-9-12(14(18)10-16)7-8-17(13)4/h7,13H,8-11H2,1-6H3/t13-/m1/s1 |
| InChIKey | FVKHCYVYNGOFDE-CYBMUJFWSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|