C16H30N2O3Si — CID 101223532
(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-ethyl-1-methyl-6-oxo-2,3-dihydropyridine-5-carboxamide (PubChem CID 101223532) has the molecular formula C16H30N2O3Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-ethyl-1-methyl-6-oxo-2,3-dihydropyridine-5-carboxamide.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-ethyl-1-methyl-6-oxo-2,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 101223532 |
| Molecular Formula | C16H30N2O3Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-ethyl-1-methyl-6-oxo-2,3-dihydropyridine-5-carboxamide |
| SMILES | CCNC(=O)C1=CC[C@H](CO[Si](C)(C)C(C)(C)C)N(C)C1=O |
| InChI | InChI=1S/C16H30N2O3Si/c1-8-17-14(19)13-10-9-12(18(5)15(13)20)11-21-22(6,7)16(2,3)4/h10,12H,8-9,11H2,1-7H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | DZUWLOFBUAYCIT-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|