C12H24F2N2O3Si — CID 174233839
(2R,4R)-4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoropyrrolidine-1-carboxylic acid (PubChem CID 174233839) has the molecular formula C12H24F2N2O3Si and a molecular weight of 310.42 g/mol. Its IUPAC name is (2R,4R)-4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoropyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4R)-4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoropyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174233839 |
| Molecular Formula | C12H24F2N2O3Si |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2R,4R)-4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoropyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1N(C(=O)O)C[C@@H](N)C1(F)F |
| InChI | InChI=1S/C12H24F2N2O3Si/c1-11(2,3)20(4,5)19-7-9-12(13,14)8(15)6-16(9)10(17)18/h8-9H,6-7,15H2,1-5H3,(H,17,18)/t8-,9-/m1/s1 |
| InChIKey | ZWNKOLPLYRCZOO-RKDXNWHRSA-N |
| XLogP | 2.33 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|