C17H30O5Si — CID 139262763
(3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-9-one (PubChem CID 139262763) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-9-one.
| Compound Name | (3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-9-one |
|---|---|
| PubChem CID | 139262763 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-9-one |
| SMILES | CC1(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](O)/C=C\C(=O)[C@H]2O1 |
| InChI | InChI=1S/C17H30O5Si/c1-16(2,3)23(6,7)22-13-10-11(18)8-9-12(19)14-15(13)21-17(4,5)20-14/h8-9,11,13-15,18H,10H2,1-7H3/b9-8-/t11-,13-,14+,15-/m0/s1 |
| InChIKey | JUGMTSMPPWLPRX-FGIAUVEGSA-N |
| XLogP | 2.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|