C16H28O7Si — CID 101358834
[(3aR,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl] acetate (PubChem CID 101358834) has the molecular formula C16H28O7Si and a molecular weight of 360.48 g/mol. Its IUPAC name is [(3aR,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl] acetate.
| Compound Name | [(3aR,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl] acetate |
|---|---|
| PubChem CID | 101358834 |
| Molecular Formula | C16H28O7Si |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(3aR,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O7Si/c1-9(17)19-14-12(23-24(7,8)15(2,3)4)10-11(13(18)20-14)22-16(5,6)21-10/h10-12,14H,1-8H3/t10-,11+,12-,14-/m0/s1 |
| InChIKey | UFAITZKJVXFKMI-OPDFLTKYSA-N |
| XLogP | 2.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|