C23H40O5Si — CID 101109253
[(2Z)-2-[(3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-ylidene]ethyl] 2,2-dimethylpropanoate (PubChem CID 101109253) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is [(2Z)-2-[(3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-ylidene]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2Z)-2-[(3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-ylidene]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101109253 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(2Z)-2-[(3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-ylidene]ethyl] 2,2-dimethylpropanoate |
| SMILES | C=C1/C(=C\COC(=O)C(C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C23H40O5Si/c1-15-16(12-13-25-20(24)21(2,3)4)14-17(28-29(10,11)22(5,6)7)19-18(15)26-23(8,9)27-19/h12,17-19H,1,13-14H2,2-11H3/b16-12-/t17-,18-,19-/m1/s1 |
| InChIKey | NGAZTPJTXNBKSN-LQBYRGBVSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|