C25H36O4Si — CID 11069984
(1R,2R,7S,12S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9,14-triene-3,6-dione (PubChem CID 11069984) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is (1R,2R,7S,12S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9,14-triene-3,6-dione.
| Compound Name | (1R,2R,7S,12S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9,14-triene-3,6-dione |
|---|---|
| PubChem CID | 11069984 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (1R,2R,7S,12S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,14,15-tetramethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9,14-triene-3,6-dione |
| SMILES | CC1=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]4OC(C)=C(C)[C@@H]4[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C25H36O4Si/c1-13-10-18(26)17-12-19(29-30(8,9)24(4,5)6)16-11-20-21(14(2)15(3)28-20)22(16)25(17,7)23(13)27/h10,17,20-22H,11-12H2,1-9H3/t17-,20+,21+,22+,25+/m1/s1 |
| InChIKey | OKMMTUCHTHXECC-BVMUCEKZSA-N |
| XLogP | 5.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|