C26H32O5Si — CID 161197599
(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2H-furan-5-one (PubChem CID 161197599) has the molecular formula C26H32O5Si and a molecular weight of 452.62 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 161197599 |
| Molecular Formula | C26H32O5Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2H-furan-5-one |
| SMILES | CC1=C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C26H32O5Si/c1-18-22(21-17-28-26(5,6)30-21)29-24(27)23(18)31-32(25(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-22H,17H2,1-6H3/t21-,22-/m0/s1 |
| InChIKey | FAJBCYJKADURTR-VXKWHMMOSA-N |
| XLogP | 3.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|