C29H39NO7Si — CID 177497464
N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-[tert-butyl(diphenyl)silyl]oxymethanimine oxide (PubChem CID 177497464) has the molecular formula C29H39NO7Si and a molecular weight of 541.72 g/mol. Its IUPAC name is N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-[tert-butyl(diphenyl)silyl]oxymethanimine oxide.
| Compound Name | N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-[tert-butyl(diphenyl)silyl]oxymethanimine oxide |
|---|---|
| PubChem CID | 177497464 |
| Molecular Formula | C29H39NO7Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-[tert-butyl(diphenyl)silyl]oxymethanimine oxide |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H]3COC(C)(C)O3)O[C@H](/[N+]([O-])=C/O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C29H39NO7Si/c1-27(2,3)38(20-14-10-8-11-15-20,21-16-12-9-13-17-21)33-19-30(31)26-25-24(36-29(6,7)37-25)23(34-26)22-18-32-28(4,5)35-22/h8-17,19,22-26H,18H2,1-7H3/b30-19-/t22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | JDPRUATYDDQIMI-CBQHTLOVSA-N |
| XLogP | 3.50 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|