C27H38O5Si — CID 12039247
2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethanol (PubChem CID 12039247) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethanol.
| Compound Name | 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethanol |
|---|---|
| PubChem CID | 12039247 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethanol |
| SMILES | CC1(C)OC[C@H]([C@H]2OC[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2CCO)O1 |
| InChI | InChI=1S/C27H38O5Si/c1-26(2,3)33(20-12-8-6-9-13-20,21-14-10-7-11-15-21)32-23-18-29-25(22(23)16-17-28)24-19-30-27(4,5)31-24/h6-15,22-25,28H,16-19H2,1-5H3/t22-,23-,24+,25-/m0/s1 |
| InChIKey | ZMVPKDWANOWNTJ-JBXUNAHCSA-N |
| XLogP | 3.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|