C26H34O6Si — CID 122385253
[(1R,2R,6R,9S,11R)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-11-yl]methanol (PubChem CID 122385253) has the molecular formula C26H34O6Si and a molecular weight of 470.64 g/mol. Its IUPAC name is [(1R,2R,6R,9S,11R)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-11-yl]methanol.
| Compound Name | [(1R,2R,6R,9S,11R)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-11-yl]methanol |
|---|---|
| PubChem CID | 122385253 |
| Molecular Formula | C26H34O6Si |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [(1R,2R,6R,9S,11R)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-11-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@]1(CO)C[C@@H]2OC[C@H]3OCO[C@H]3[C@@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34O6Si/c1-25(2,3)33(19-10-6-4-7-11-19,20-12-8-5-9-13-20)31-17-26(16-27)14-21-24(32-26)23-22(15-28-21)29-18-30-23/h4-13,21-24,27H,14-18H2,1-3H3/t21-,22+,23+,24+,26+/m0/s1 |
| InChIKey | FXQBNLQJCUHCQF-VIMOMQNVSA-N |
| XLogP | 2.22 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|