C23H30O3Si — CID 159902587
tert-butyl-[[(4R)-3-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]-diphenylsilane (PubChem CID 159902587) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is tert-butyl-[[(4R)-3-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R)-3-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 159902587 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl-[[(4R)-3-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]-diphenylsilane |
| SMILES | CC1COC2OC[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C12 |
| InChI | InChI=1S/C23H30O3Si/c1-17-15-24-22-21(17)20(16-25-22)26-27(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20-22H,15-16H2,1-4H3/t17?,20-,21?,22?/m0/s1 |
| InChIKey | QNFUPYWMMQFJFY-CSNNXXKCSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|