C22H26O4Si — CID 15327231
6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 15327231) has the molecular formula C22H26O4Si and a molecular weight of 382.53 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 15327231 |
| Molecular Formula | C22H26O4Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H26O4Si/c1-21(2,3)27(17-12-8-6-9-13-17,18-14-10-7-11-15-18)26-20-16-19(23)24-22(4,5)25-20/h6-16H,1-5H3 |
| InChIKey | UKLJVFCQYZFUCY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|