C30H34O6Si — CID 11283769
5-[[2-[tert-butyl(diphenyl)silyl]oxy-5-methoxyphenyl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 11283769) has the molecular formula C30H34O6Si and a molecular weight of 518.68 g/mol. Its IUPAC name is 5-[[2-[tert-butyl(diphenyl)silyl]oxy-5-methoxyphenyl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2-[tert-butyl(diphenyl)silyl]oxy-5-methoxyphenyl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11283769 |
| Molecular Formula | C30H34O6Si |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 5-[[2-[tert-butyl(diphenyl)silyl]oxy-5-methoxyphenyl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(CC2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C30H34O6Si/c1-29(2,3)37(23-13-9-7-10-14-23,24-15-11-8-12-16-24)36-26-18-17-22(33-6)19-21(26)20-25-27(31)34-30(4,5)35-28(25)32/h7-19,25H,20H2,1-6H3 |
| InChIKey | YVCKHMIDBCOBGU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|