C35H42O6Si — CID 46930478
tert-butyl (1R,5R,7R)-7-[4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]-2-oxo-8-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 46930478) has the molecular formula C35H42O6Si and a molecular weight of 586.80 g/mol. Its IUPAC name is tert-butyl (1R,5R,7R)-7-[4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]-2-oxo-8-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | tert-butyl (1R,5R,7R)-7-[4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]-2-oxo-8-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 46930478 |
| Molecular Formula | C35H42O6Si |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | tert-butyl (1R,5R,7R)-7-[4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]-2-oxo-8-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COc1cc([C@H]2C[C@H]3CCC(=O)[C@]2(C(=O)OC(C)(C)C)O3)ccc1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H42O6Si/c1-33(2,3)40-32(37)35-28(23-25(39-35)19-21-31(35)36)24-18-20-29(30(22-24)38-7)41-42(34(4,5)6,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h8-18,20,22,25,28H,19,21,23H2,1-7H3/t25-,28-,35-/m1/s1 |
| InChIKey | XUCMRSYFMMSHNM-RQDKSTKUSA-N |
| XLogP | 5.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|