C32H33NO3Si — CID 10696962
(3S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 10696962) has the molecular formula C32H33NO3Si and a molecular weight of 507.71 g/mol. Its IUPAC name is (3S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | (3S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 10696962 |
| Molecular Formula | C32H33NO3Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (3S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | COc1ccc2c(c1)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](c1ccccc1)NC2=O |
| InChI | InChI=1S/C32H33NO3Si/c1-32(2,3)37(25-16-10-6-11-17-25,26-18-12-7-13-19-26)36-30-28-22-24(35-4)20-21-27(28)31(34)33-29(30)23-14-8-5-9-15-23/h5-22,29-30H,1-4H3,(H,33,34)/t29-,30+/m0/s1 |
| InChIKey | XPHOVFTYDKNWOH-XZWHSSHBSA-N |
| XLogP | 5.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|