C16H15NO3 — CID 10400879
8-methoxy-2-phenyl-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 10400879) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 8-methoxy-2-phenyl-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 8-methoxy-2-phenyl-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 10400879 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 8-methoxy-2-phenyl-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc2c(c1)OC(c1ccccc1)CNC2=O |
| InChI | InChI=1S/C16H15NO3/c1-19-12-7-8-13-14(9-12)20-15(10-17-16(13)18)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3,(H,17,18) |
| InChIKey | MCNSSHMIQBBMCP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |