About 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one
2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 158495868) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 158495868 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)C.O=C1NC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C9H9NO2.C4H10/c11-9-10-6-8(12-9)7-4-2-1-3-5-7;1-4(2)3/h1-5,8H,6H2,(H,10,11);4H,1-3H3/t8-;/m0./s1 |
| InChIKey | HJGZGPYLHRQAGV-QRPNPIFTSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one (CID 158495868) is 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one is CC(C)C.O=C1NC[C@@H](c2ccccc2)O1.
What is the InChIKey of 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one?
The InChIKey is HJGZGPYLHRQAGV-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H9NO2.C4H10/c11-9-10-6-8(12-9)7-4-2-1-3-5-7;1-4(2)3/h1-5,8H,6H2,(H,10,11);4H,1-3H3/t8-;/m0./s1.
What are the key properties of 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one?
2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one has a molecular weight of 221.30 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;(5R)-5-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 158495868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).