C24H28O3Si — CID 152599118
(6S,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-6a-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one (PubChem CID 152599118) has the molecular formula C24H28O3Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (6S,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-6a-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one.
| Compound Name | (6S,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-6a-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 152599118 |
| Molecular Formula | C24H28O3Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (6S,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-6a-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](O[C@H]1CCC2=CC(=O)O[C@@]21C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O3Si/c1-23(2,3)28(19-11-7-5-8-12-19,20-13-9-6-10-14-20)27-21-16-15-18-17-22(25)26-24(18,21)4/h5-14,17,21H,15-16H2,1-4H3/t21-,24-/m0/s1 |
| InChIKey | YXDGUCOLKAGROH-URXFXBBRSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|