C27H40O7Si — CID 10994751
methyl 2-[(1R,2R,3S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyl-6,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-3-yl]acetate (PubChem CID 10994751) has the molecular formula C27H40O7Si and a molecular weight of 504.70 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyl-6,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-3-yl]acetate.
| Compound Name | methyl 2-[(1R,2R,3S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyl-6,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-3-yl]acetate |
|---|---|
| PubChem CID | 10994751 |
| Molecular Formula | C27H40O7Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | methyl 2-[(1R,2R,3S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyl-6,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-3-yl]acetate |
| SMILES | COC(=O)C[C@]1(OC)C(C)=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]4OC(=O)C[C@@H]4[C@H]3[C@]21C |
| InChI | InChI=1S/C27H40O7Si/c1-15-10-19(28)18-13-21(34-35(8,9)25(2,3)4)16-11-20-17(12-22(29)33-20)24(16)26(18,5)27(15,32-7)14-23(30)31-6/h10,17-18,20,24H,11-14H2,1-9H3/t17-,18+,20-,24-,26-,27-/m0/s1 |
| InChIKey | TZANJHHZXMOYCQ-KADGVFLUSA-N |
| XLogP | 4.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|