C22H36O3Si — CID 11132573
(5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one (PubChem CID 11132573) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one.
| Compound Name | (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
|---|---|
| PubChem CID | 11132573 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
| SMILES | CO[C@H]1C=C(C)C(=O)[C@]2(C)[C@@H]3CCCC3=C(O[Si](C)(C)C(C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C22H36O3Si/c1-14-12-19(24-6)17-13-18(25-26(7,8)21(2,3)4)15-10-9-11-16(15)22(17,5)20(14)23/h12,16-17,19H,9-11,13H2,1-8H3/t16-,17-,19+,22-/m1/s1 |
| InChIKey | ACZQCPDPCMQYPX-KZFRKFNSSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|