C20H36OSi — CID 71492113
tert-butyl-dimethyl-[[(4S,11R)-2,2,4-trimethyl-8-tricyclo[5.3.1.04,11]undec-7-enyl]oxy]silane (PubChem CID 71492113) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(4S,11R)-2,2,4-trimethyl-8-tricyclo[5.3.1.04,11]undec-7-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(4S,11R)-2,2,4-trimethyl-8-tricyclo[5.3.1.04,11]undec-7-enyl]oxy]silane |
|---|---|
| PubChem CID | 71492113 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(4S,11R)-2,2,4-trimethyl-8-tricyclo[5.3.1.04,11]undec-7-enyl]oxy]silane |
| SMILES | CC1(C)C[C@]2(C)CCC3=C(O[Si](C)(C)C(C)(C)C)CCC1[C@@H]32 |
| InChI | InChI=1S/C20H36OSi/c1-18(2,3)22(7,8)21-16-10-9-15-17-14(16)11-12-20(17,6)13-19(15,4)5/h15,17H,9-13H2,1-8H3/t15?,17-,20+/m1/s1 |
| InChIKey | FSHVODVHTYUJTD-DFWLKAPTSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|