C22H38O3Si — CID 24905634
(1S,4R,11R,13S)-9-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-8-ene-11-carbaldehyde (PubChem CID 24905634) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is (1S,4R,11R,13S)-9-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-8-ene-11-carbaldehyde.
| Compound Name | (1S,4R,11R,13S)-9-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-8-ene-11-carbaldehyde |
|---|---|
| PubChem CID | 24905634 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (1S,4R,11R,13S)-9-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-8-ene-11-carbaldehyde |
| SMILES | CC1(C)OCC2=C(O[Si](C)(C)C(C)(C)C)C[C@@H](C=O)[C@@]3(C)CC[C@@H]1[C@@H]2C3 |
| InChI | InChI=1S/C22H38O3Si/c1-20(2,3)26(7,8)25-19-11-15(13-23)22(6)10-9-18-16(12-22)17(19)14-24-21(18,4)5/h13,15-16,18H,9-12,14H2,1-8H3/t15-,16+,18+,22-/m0/s1 |
| InChIKey | ZQEGNEQYMUVQRY-PAODICLVSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|