C31H50O6Si — CID 134831859
[(E)-2-[(1S,8R,10S,11S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-9-oxo-10-(2-oxopropyl)-6-oxatricyclo[6.3.2.04,13]tridecan-11-yl]ethenyl] 3-methylbut-2-enoate (PubChem CID 134831859) has the molecular formula C31H50O6Si and a molecular weight of 546.82 g/mol. Its IUPAC name is [(E)-2-[(1S,8R,10S,11S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-9-oxo-10-(2-oxopropyl)-6-oxatricyclo[6.3.2.04,13]tridecan-11-yl]ethenyl] 3-methylbut-2-enoate.
| Compound Name | [(E)-2-[(1S,8R,10S,11S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-9-oxo-10-(2-oxopropyl)-6-oxatricyclo[6.3.2.04,13]tridecan-11-yl]ethenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 134831859 |
| Molecular Formula | C31H50O6Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | [(E)-2-[(1S,8R,10S,11S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethyl-9-oxo-10-(2-oxopropyl)-6-oxatricyclo[6.3.2.04,13]tridecan-11-yl]ethenyl] 3-methylbut-2-enoate |
| SMILES | CC(=O)C[C@@H]1C(=O)[C@]2(O[Si](C)(C)C(C)(C)C)COC(C)(C)C3CC[C@@](C)(CC32)[C@H]1/C=C/OC(=O)C=C(C)C |
| InChI | InChI=1S/C31H50O6Si/c1-20(2)16-26(33)35-15-13-23-22(17-21(3)32)27(34)31(37-38(10,11)28(4,5)6)19-36-29(7,8)24-12-14-30(23,9)18-25(24)31/h13,15-16,22-25H,12,14,17-19H2,1-11H3/b15-13+/t22-,23-,24?,25?,30-,31-/m0/s1 |
| InChIKey | RCUBIMQMLREZDV-DGOODAKRSA-N |
| XLogP | 6.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|