C26H36O5 — CID 162944938
2-[(1R,7R,8S,11R,15S)-1-methoxy-4,8,12,12-tetramethyl-3,13-dioxatetracyclo[6.6.2.02,6.011,15]hexadeca-2(6),4-dien-7-yl]ethenyl 3-methylbut-2-enoate (PubChem CID 162944938) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[(1R,7R,8S,11R,15S)-1-methoxy-4,8,12,12-tetramethyl-3,13-dioxatetracyclo[6.6.2.02,6.011,15]hexadeca-2(6),4-dien-7-yl]ethenyl 3-methylbut-2-enoate.
| Compound Name | 2-[(1R,7R,8S,11R,15S)-1-methoxy-4,8,12,12-tetramethyl-3,13-dioxatetracyclo[6.6.2.02,6.011,15]hexadeca-2(6),4-dien-7-yl]ethenyl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162944938 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[(1R,7R,8S,11R,15S)-1-methoxy-4,8,12,12-tetramethyl-3,13-dioxatetracyclo[6.6.2.02,6.011,15]hexadeca-2(6),4-dien-7-yl]ethenyl 3-methylbut-2-enoate |
| SMILES | CO[C@@]12COC(C)(C)[C@@H]3CC[C@@](C)(C[C@@H]31)[C@@H](C=COC(=O)C=C(C)C)c1cc(C)oc12 |
| InChI | InChI=1S/C26H36O5/c1-16(2)12-22(27)29-11-9-19-18-13-17(3)31-23(18)26(28-7)15-30-24(4,5)20-8-10-25(19,6)14-21(20)26/h9,11-13,19-21H,8,10,14-15H2,1-7H3/t19-,20+,21-,25-,26-/m0/s1 |
| InChIKey | MQLDUXIMSMUVOZ-SQDCTEAMSA-N |
| XLogP | 5.78 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|