C26H38O5 — CID 10950055
[(E)-2-[(1S,5S,7S,8S,9S,12S)-2-formyl-5-methoxy-5,9-dimethyl-12-propan-2-yl-4-oxatricyclo[7.3.1.03,7]tridec-2-en-8-yl]ethenyl] 3-methylbut-2-enoate (PubChem CID 10950055) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(E)-2-[(1S,5S,7S,8S,9S,12S)-2-formyl-5-methoxy-5,9-dimethyl-12-propan-2-yl-4-oxatricyclo[7.3.1.03,7]tridec-2-en-8-yl]ethenyl] 3-methylbut-2-enoate.
| Compound Name | [(E)-2-[(1S,5S,7S,8S,9S,12S)-2-formyl-5-methoxy-5,9-dimethyl-12-propan-2-yl-4-oxatricyclo[7.3.1.03,7]tridec-2-en-8-yl]ethenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10950055 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(E)-2-[(1S,5S,7S,8S,9S,12S)-2-formyl-5-methoxy-5,9-dimethyl-12-propan-2-yl-4-oxatricyclo[7.3.1.03,7]tridec-2-en-8-yl]ethenyl] 3-methylbut-2-enoate |
| SMILES | CO[C@]1(C)C[C@@H]2C(=C(C=O)[C@H]3C[C@](C)(CC[C@H]3C(C)C)[C@H]2/C=C/OC(=O)C=C(C)C)O1 |
| InChI | InChI=1S/C26H38O5/c1-16(2)12-23(28)30-11-9-22-20-14-26(6,29-7)31-24(20)21(15-27)19-13-25(22,5)10-8-18(19)17(3)4/h9,11-12,15,17-20,22H,8,10,13-14H2,1-7H3/b11-9+/t18-,19-,20-,22-,25-,26-/m0/s1 |
| InChIKey | JXTSCYYSAKVTKY-APLSZBHBSA-N |
| XLogP | 5.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|