C25H34O4 — CID 23250491
[(E)-2-[(3aS,8S,9R,9aS)-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydrofuro[2,3-i][2]benzofuran-9-yl]ethenyl] 3-methylbut-2-enoate (PubChem CID 23250491) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is [(E)-2-[(3aS,8S,9R,9aS)-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydrofuro[2,3-i][2]benzofuran-9-yl]ethenyl] 3-methylbut-2-enoate.
| Compound Name | [(E)-2-[(3aS,8S,9R,9aS)-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydrofuro[2,3-i][2]benzofuran-9-yl]ethenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 23250491 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(E)-2-[(3aS,8S,9R,9aS)-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydrofuro[2,3-i][2]benzofuran-9-yl]ethenyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CCC[C@@]1(C)CC=C2CO[C@H]3C=C(C)O[C@@]23[C@@H]1/C=C/OC(=O)C=C(C)C |
| InChI | InChI=1S/C25H34O4/c1-17(2)8-7-11-24(6)12-9-20-16-28-22-15-19(5)29-25(20,22)21(24)10-13-27-23(26)14-18(3)4/h8-10,13-15,21-22H,7,11-12,16H2,1-6H3/b13-10+/t21-,22+,24+,25-/m1/s1 |
| InChIKey | VCDKHPDJOCIZOP-FCYIJLCMSA-N |
| XLogP | 5.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|