C27H42O4 — CID 158876041
[(1R,4S,6Z,10R,11S)-7-ethyl-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,6-dien-1-yl] 3-methylbut-2-enoate (PubChem CID 158876041) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is [(1R,4S,6Z,10R,11S)-7-ethyl-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,6-dien-1-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,4S,6Z,10R,11S)-7-ethyl-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,6-dien-1-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 158876041 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | [(1R,4S,6Z,10R,11S)-7-ethyl-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,6-dien-1-yl] 3-methylbut-2-enoate |
| SMILES | CC/C1=C/C[C@](C)(CCC=C(C)C)C=C[C@@H](OC(=O)C=C(C)C)[C@@H](C)[C@H](OC)CC1=O |
| InChI | InChI=1S/C27H42O4/c1-9-22-12-15-27(7,14-10-11-19(2)3)16-13-24(31-26(29)17-20(4)5)21(6)25(30-8)18-23(22)28/h11-13,16-17,21,24-25H,9-10,14-15,18H2,1-8H3/b16-13?,22-12-/t21-,24-,25-,27+/m1/s1 |
| InChIKey | JCLGIJBFZLTOJP-IVCAJMRWSA-N |
| XLogP | 6.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|