C21H34O9 — CID 162985905
[2,4,6-trihydroxy-3-(3-methylbutanoyloxy)-5-(3-methylbut-2-enoyloxy)cyclohexyl] 3-methylbutanoate (PubChem CID 162985905) has the molecular formula C21H34O9 and a molecular weight of 430.49 g/mol. Its IUPAC name is [2,4,6-trihydroxy-3-(3-methylbutanoyloxy)-5-(3-methylbut-2-enoyloxy)cyclohexyl] 3-methylbutanoate.
| Compound Name | [2,4,6-trihydroxy-3-(3-methylbutanoyloxy)-5-(3-methylbut-2-enoyloxy)cyclohexyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162985905 |
| Molecular Formula | C21H34O9 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [2,4,6-trihydroxy-3-(3-methylbutanoyloxy)-5-(3-methylbut-2-enoyloxy)cyclohexyl] 3-methylbutanoate |
| SMILES | CC(C)=CC(=O)OC1C(O)C(OC(=O)CC(C)C)C(O)C(OC(=O)CC(C)C)C1O |
| InChI | InChI=1S/C21H34O9/c1-10(2)7-13(22)28-19-16(25)20(29-14(23)8-11(3)4)18(27)21(17(19)26)30-15(24)9-12(5)6/h7,11-12,16-21,25-27H,8-9H2,1-6H3 |
| InChIKey | HNNKYBNBYRASRR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|