C20H34O8 — CID 102056148
[(1S,2R,3R,4R,5S,6R)-2,4,6-trihydroxy-3-(3-methylbut-2-enoyloxy)-5-(2-methylpropoxy)cyclohexyl] 2-methylbutanoate (PubChem CID 102056148) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5S,6R)-2,4,6-trihydroxy-3-(3-methylbut-2-enoyloxy)-5-(2-methylpropoxy)cyclohexyl] 2-methylbutanoate.
| Compound Name | [(1S,2R,3R,4R,5S,6R)-2,4,6-trihydroxy-3-(3-methylbut-2-enoyloxy)-5-(2-methylpropoxy)cyclohexyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 102056148 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [(1S,2R,3R,4R,5S,6R)-2,4,6-trihydroxy-3-(3-methylbut-2-enoyloxy)-5-(2-methylpropoxy)cyclohexyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1[C@H](O)[C@H](OCC(C)C)[C@@H](O)[C@@H](OC(=O)C=C(C)C)[C@@H]1O |
| InChI | InChI=1S/C20H34O8/c1-7-12(6)20(25)28-19-15(23)17(26-9-11(4)5)14(22)18(16(19)24)27-13(21)8-10(2)3/h8,11-12,14-19,22-24H,7,9H2,1-6H3/t12?,14-,15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | KXWKKUCWDQQCSU-QBBGYUDZSA-N |
| XLogP | 0.96 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|